C19H16FN3O3 — CID 136834452
N-(3-fluorophenyl)-2-[(4-methoxyphenyl)methyl]-6-oxo-1H-pyrimidine-4-carboxamide (PubChem CID 136834452) has the molecular formula C19H16FN3O3 and a molecular weight of 353.35 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-[(4-methoxyphenyl)methyl]-6-oxo-1H-pyrimidine-4-carboxamide.
| Compound Name | N-(3-fluorophenyl)-2-[(4-methoxyphenyl)methyl]-6-oxo-1H-pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 136834452 |
| Molecular Formula | C19H16FN3O3 |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | N-(3-fluorophenyl)-2-[(4-methoxyphenyl)methyl]-6-oxo-1H-pyrimidine-4-carboxamide |
| SMILES | COc1ccc(Cc2nc(C(=O)Nc3cccc(F)c3)cc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C19H16FN3O3/c1-26-15-7-5-12(6-8-15)9-17-22-16(11-18(24)23-17)19(25)21-14-4-2-3-13(20)10-14/h2-8,10-11H,9H2,1H3,(H,21,25)(H,22,23,24) |
| InChIKey | POKRZHNHANYBQX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |