C24H25N3O5 — CID 136705548
butyl 2-[[2-[(4-methoxyphenyl)methyl]-6-oxo-1H-pyrimidine-4-carbonyl]amino]benzoate (PubChem CID 136705548) has the molecular formula C24H25N3O5 and a molecular weight of 435.48 g/mol. Its IUPAC name is butyl 2-[[2-[(4-methoxyphenyl)methyl]-6-oxo-1H-pyrimidine-4-carbonyl]amino]benzoate.
| Compound Name | butyl 2-[[2-[(4-methoxyphenyl)methyl]-6-oxo-1H-pyrimidine-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 136705548 |
| Molecular Formula | C24H25N3O5 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | butyl 2-[[2-[(4-methoxyphenyl)methyl]-6-oxo-1H-pyrimidine-4-carbonyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1NC(=O)c1cc(=O)[nH]c(Cc2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C24H25N3O5/c1-3-4-13-32-24(30)18-7-5-6-8-19(18)26-23(29)20-15-22(28)27-21(25-20)14-16-9-11-17(31-2)12-10-16/h5-12,15H,3-4,13-14H2,1-2H3,(H,26,29)(H,25,27,28) |
| InChIKey | JSXHKYZNVJCDAF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|