C18H21N3O4S — CID 136705766
butyl 2-[[2-(methylsulfanylmethyl)-6-oxo-1H-pyrimidine-4-carbonyl]amino]benzoate (PubChem CID 136705766) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is butyl 2-[[2-(methylsulfanylmethyl)-6-oxo-1H-pyrimidine-4-carbonyl]amino]benzoate.
| Compound Name | butyl 2-[[2-(methylsulfanylmethyl)-6-oxo-1H-pyrimidine-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 136705766 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | butyl 2-[[2-(methylsulfanylmethyl)-6-oxo-1H-pyrimidine-4-carbonyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1NC(=O)c1cc(=O)[nH]c(CSC)n1 |
| InChI | InChI=1S/C18H21N3O4S/c1-3-4-9-25-18(24)12-7-5-6-8-13(12)20-17(23)14-10-16(22)21-15(19-14)11-26-2/h5-8,10H,3-4,9,11H2,1-2H3,(H,20,23)(H,19,21,22) |
| InChIKey | FYZHSUHQHNTIAG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|