C15H15N3O3S — CID 136834764
N-(2-acetylphenyl)-2-(methylsulfanylmethyl)-6-oxo-1H-pyrimidine-4-carboxamide (PubChem CID 136834764) has the molecular formula C15H15N3O3S and a molecular weight of 317.37 g/mol. Its IUPAC name is N-(2-acetylphenyl)-2-(methylsulfanylmethyl)-6-oxo-1H-pyrimidine-4-carboxamide.
| Compound Name | N-(2-acetylphenyl)-2-(methylsulfanylmethyl)-6-oxo-1H-pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 136834764 |
| Molecular Formula | C15H15N3O3S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | N-(2-acetylphenyl)-2-(methylsulfanylmethyl)-6-oxo-1H-pyrimidine-4-carboxamide |
| SMILES | CSCc1nc(C(=O)Nc2ccccc2C(C)=O)cc(=O)[nH]1 |
| InChI | InChI=1S/C15H15N3O3S/c1-9(19)10-5-3-4-6-11(10)17-15(21)12-7-14(20)18-13(16-12)8-22-2/h3-7H,8H2,1-2H3,(H,17,21)(H,16,18,20) |
| InChIKey | ZYFBHRVEKZTWJA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |