C13H10F3N3O2S — CID 136834600
2-(methylsulfanylmethyl)-6-oxo-N-(2,3,4-trifluorophenyl)-1H-pyrimidine-4-carboxamide (PubChem CID 136834600) has the molecular formula C13H10F3N3O2S and a molecular weight of 329.30 g/mol. Its IUPAC name is 2-(methylsulfanylmethyl)-6-oxo-N-(2,3,4-trifluorophenyl)-1H-pyrimidine-4-carboxamide.
| Compound Name | 2-(methylsulfanylmethyl)-6-oxo-N-(2,3,4-trifluorophenyl)-1H-pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 136834600 |
| Molecular Formula | C13H10F3N3O2S |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 2-(methylsulfanylmethyl)-6-oxo-N-(2,3,4-trifluorophenyl)-1H-pyrimidine-4-carboxamide |
| SMILES | CSCc1nc(C(=O)Nc2ccc(F)c(F)c2F)cc(=O)[nH]1 |
| InChI | InChI=1S/C13H10F3N3O2S/c1-22-5-9-17-8(4-10(20)19-9)13(21)18-7-3-2-6(14)11(15)12(7)16/h2-4H,5H2,1H3,(H,18,21)(H,17,19,20) |
| InChIKey | FBUITVMUJUZQFH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|