C13H13N3O2S — CID 136834654
2-(methylsulfanylmethyl)-6-oxo-N-phenyl-1H-pyrimidine-4-carboxamide (PubChem CID 136834654) has the molecular formula C13H13N3O2S and a molecular weight of 275.33 g/mol. Its IUPAC name is 2-(methylsulfanylmethyl)-6-oxo-N-phenyl-1H-pyrimidine-4-carboxamide.
| Compound Name | 2-(methylsulfanylmethyl)-6-oxo-N-phenyl-1H-pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 136834654 |
| Molecular Formula | C13H13N3O2S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 2-(methylsulfanylmethyl)-6-oxo-N-phenyl-1H-pyrimidine-4-carboxamide |
| SMILES | CSCc1nc(C(=O)Nc2ccccc2)cc(=O)[nH]1 |
| InChI | InChI=1S/C13H13N3O2S/c1-19-8-11-15-10(7-12(17)16-11)13(18)14-9-5-3-2-4-6-9/h2-7H,8H2,1H3,(H,14,18)(H,15,16,17) |
| InChIKey | VAVKHCSUIVAFPK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |