C21H19N3O5 — CID 136834562
3-[[[2-[(4-methoxyphenyl)methyl]-6-oxo-1H-pyrimidine-4-carbonyl]amino]methyl]benzoic acid (PubChem CID 136834562) has the molecular formula C21H19N3O5 and a molecular weight of 393.40 g/mol. Its IUPAC name is 3-[[[2-[(4-methoxyphenyl)methyl]-6-oxo-1H-pyrimidine-4-carbonyl]amino]methyl]benzoic acid.
| Compound Name | 3-[[[2-[(4-methoxyphenyl)methyl]-6-oxo-1H-pyrimidine-4-carbonyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 136834562 |
| Molecular Formula | C21H19N3O5 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 3-[[[2-[(4-methoxyphenyl)methyl]-6-oxo-1H-pyrimidine-4-carbonyl]amino]methyl]benzoic acid |
| SMILES | COc1ccc(Cc2nc(C(=O)NCc3cccc(C(=O)O)c3)cc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C21H19N3O5/c1-29-16-7-5-13(6-8-16)10-18-23-17(11-19(25)24-18)20(26)22-12-14-3-2-4-15(9-14)21(27)28/h2-9,11H,10,12H2,1H3,(H,22,26)(H,27,28)(H,23,24,25) |
| InChIKey | QTDXASXRACIYGE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |