C23H26N4O6S — CID 136782588
N-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]-2-[(4-methoxyphenyl)methyl]-6-oxo-1H-pyrimidine-4-carboxamide (PubChem CID 136782588) has the molecular formula C23H26N4O6S and a molecular weight of 486.55 g/mol. Its IUPAC name is N-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]-2-[(4-methoxyphenyl)methyl]-6-oxo-1H-pyrimidine-4-carboxamide.
| Compound Name | N-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]-2-[(4-methoxyphenyl)methyl]-6-oxo-1H-pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 136782588 |
| Molecular Formula | C23H26N4O6S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | N-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]-2-[(4-methoxyphenyl)methyl]-6-oxo-1H-pyrimidine-4-carboxamide |
| SMILES | COCCNS(=O)(=O)c1ccc(CNC(=O)c2cc(=O)[nH]c(Cc3ccc(OC)cc3)n2)cc1 |
| InChI | InChI=1S/C23H26N4O6S/c1-32-12-11-25-34(30,31)19-9-5-17(6-10-19)15-24-23(29)20-14-22(28)27-21(26-20)13-16-3-7-18(33-2)8-4-16/h3-10,14,25H,11-13,15H2,1-2H3,(H,24,29)(H,26,27,28) |
| InChIKey | ABTQJHOWZOSBHC-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|