C18H19N3O7 — CID 136705602
2-[[2-[(4-methoxyphenyl)methyl]-6-oxo-1H-pyrimidine-4-carbonyl]amino]pentanedioic acid (PubChem CID 136705602) has the molecular formula C18H19N3O7 and a molecular weight of 389.36 g/mol. Its IUPAC name is 2-[[2-[(4-methoxyphenyl)methyl]-6-oxo-1H-pyrimidine-4-carbonyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[(4-methoxyphenyl)methyl]-6-oxo-1H-pyrimidine-4-carbonyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 136705602 |
| Molecular Formula | C18H19N3O7 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 2-[[2-[(4-methoxyphenyl)methyl]-6-oxo-1H-pyrimidine-4-carbonyl]amino]pentanedioic acid |
| SMILES | COc1ccc(Cc2nc(C(=O)NC(CCC(=O)O)C(=O)O)cc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C18H19N3O7/c1-28-11-4-2-10(3-5-11)8-14-19-13(9-15(22)21-14)17(25)20-12(18(26)27)6-7-16(23)24/h2-5,9,12H,6-8H2,1H3,(H,20,25)(H,23,24)(H,26,27)(H,19,21,22) |
| InChIKey | RAWKFXXGPVBCAA-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 158.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |