C13H12Cl2N2OS — CID 110332846
N-(2,4-dichlorophenyl)-3-(2-methyl-1,3-thiazol-4-yl)propanamide (PubChem CID 110332846) has the molecular formula C13H12Cl2N2OS and a molecular weight of 315.23 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-3-(2-methyl-1,3-thiazol-4-yl)propanamide.
| Compound Name | N-(2,4-dichlorophenyl)-3-(2-methyl-1,3-thiazol-4-yl)propanamide |
|---|---|
| PubChem CID | 110332846 |
| Molecular Formula | C13H12Cl2N2OS |
| Molecular Weight | 315.23 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | N-(2,4-dichlorophenyl)-3-(2-methyl-1,3-thiazol-4-yl)propanamide |
| SMILES | Cc1nc(CCC(=O)Nc2ccc(Cl)cc2Cl)cs1 |
| InChI | InChI=1S/C13H12Cl2N2OS/c1-8-16-10(7-19-8)3-5-13(18)17-12-4-2-9(14)6-11(12)15/h2,4,6-7H,3,5H2,1H3,(H,17,18) |
| InChIKey | IPYHEPNYIPJTBH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.23 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |