C22H25ClN2OS — CID 112833785
N-[4-(1-adamantyl)-2-chlorophenyl]-2-(2-methyl-1,3-thiazol-4-yl)acetamide (PubChem CID 112833785) has the molecular formula C22H25ClN2OS and a molecular weight of 400.98 g/mol. Its IUPAC name is N-[4-(1-adamantyl)-2-chlorophenyl]-2-(2-methyl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-[4-(1-adamantyl)-2-chlorophenyl]-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 112833785 |
| Molecular Formula | C22H25ClN2OS |
| Molecular Weight | 400.98 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | N-[4-(1-adamantyl)-2-chlorophenyl]-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
| SMILES | Cc1nc(CC(=O)Nc2ccc(C34CC5CC(CC(C5)C3)C4)cc2Cl)cs1 |
| InChI | InChI=1S/C22H25ClN2OS/c1-13-24-18(12-27-13)8-21(26)25-20-3-2-17(7-19(20)23)22-9-14-4-15(10-22)6-16(5-14)11-22/h2-3,7,12,14-16H,4-6,8-11H2,1H3,(H,25,26) |
| InChIKey | MQLPVNFSUQOHHH-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.98 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |