C14H16N4O3 — CID 11033526
6-amino-5-[(4-methoxyphenyl)methylideneamino]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 11033526) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is 6-amino-5-[(4-methoxyphenyl)methylideneamino]-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 6-amino-5-[(4-methoxyphenyl)methylideneamino]-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11033526 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 6-amino-5-[(4-methoxyphenyl)methylideneamino]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | COc1ccc(/C=N/c2c(N)n(C)c(=O)n(C)c2=O)cc1 |
| InChI | InChI=1S/C14H16N4O3/c1-17-12(15)11(13(19)18(2)14(17)20)16-8-9-4-6-10(21-3)7-5-9/h4-8H,15H2,1-3H3/b16-8+ |
| InChIKey | PZZNVGKIFGQWLR-LZYBPNLTSA-N |
| XLogP | 0.43 |
| TPSA | 91.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|