C21H28N4O4 — CID 46188301
6-amino-5-[(4-cyclopentyloxy-3-methoxyphenyl)methylideneamino]-1-methyl-3-propylpyrimidine-2,4-dione (PubChem CID 46188301) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is 6-amino-5-[(4-cyclopentyloxy-3-methoxyphenyl)methylideneamino]-1-methyl-3-propylpyrimidine-2,4-dione.
| Compound Name | 6-amino-5-[(4-cyclopentyloxy-3-methoxyphenyl)methylideneamino]-1-methyl-3-propylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 46188301 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 6-amino-5-[(4-cyclopentyloxy-3-methoxyphenyl)methylideneamino]-1-methyl-3-propylpyrimidine-2,4-dione |
| SMILES | CCCn1c(=O)c(/N=C/c2ccc(OC3CCCC3)c(OC)c2)c(N)n(C)c1=O |
| InChI | InChI=1S/C21H28N4O4/c1-4-11-25-20(26)18(19(22)24(2)21(25)27)23-13-14-9-10-16(17(12-14)28-3)29-15-7-5-6-8-15/h9-10,12-13,15H,4-8,11,22H2,1-3H3/b23-13+ |
| InChIKey | WYYZASRTUVTGCG-YDZHTSKRSA-N |
| XLogP | 2.62 |
| TPSA | 100.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|