C14H15F3N4O3S — CID 110335743
2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl-methylamino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 110335743) has the molecular formula C14H15F3N4O3S and a molecular weight of 376.36 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl-methylamino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl-methylamino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 110335743 |
| Molecular Formula | C14H15F3N4O3S |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl-methylamino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)N(C)CC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H15F3N4O3S/c1-7-14(8(2)20-19-7)25(23,24)21(3)6-11(22)18-10-5-4-9(15)12(16)13(10)17/h4-5H,6H2,1-3H3,(H,18,22)(H,19,20) |
| InChIKey | LODMLCCGIYXUGD-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|