C14H22N4O3S — CID 110335758
1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-N-prop-2-enylpiperidine-3-carboxamide (PubChem CID 110335758) has the molecular formula C14H22N4O3S and a molecular weight of 326.42 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-N-prop-2-enylpiperidine-3-carboxamide.
| Compound Name | 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-N-prop-2-enylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 110335758 |
| Molecular Formula | C14H22N4O3S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-N-prop-2-enylpiperidine-3-carboxamide |
| SMILES | C=CCNC(=O)C1CCCN(S(=O)(=O)c2c(C)n[nH]c2C)C1 |
| InChI | InChI=1S/C14H22N4O3S/c1-4-7-15-14(19)12-6-5-8-18(9-12)22(20,21)13-10(2)16-17-11(13)3/h4,12H,1,5-9H2,2-3H3,(H,15,19)(H,16,17) |
| InChIKey | AQVMBGSWOQBSEQ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|