C15H24N4O5S — CID 119352502
4-[[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidine-3-carbonyl]amino]butanoic acid (PubChem CID 119352502) has the molecular formula C15H24N4O5S and a molecular weight of 372.45 g/mol. Its IUPAC name is 4-[[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidine-3-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidine-3-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119352502 |
| Molecular Formula | C15H24N4O5S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 4-[[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidine-3-carbonyl]amino]butanoic acid |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)N1CCCC(C(=O)NCCCC(=O)O)C1 |
| InChI | InChI=1S/C15H24N4O5S/c1-10-14(11(2)18-17-10)25(23,24)19-8-4-5-12(9-19)15(22)16-7-3-6-13(20)21/h12H,3-9H2,1-2H3,(H,16,22)(H,17,18)(H,20,21) |
| InChIKey | JWXKZEVQWCCKOP-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 132.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|