C19H30N2O4S — CID 110335879
N-benzyl-1-(2-methoxyethylsulfonyl)-N-propan-2-ylpiperidine-3-carboxamide (PubChem CID 110335879) has the molecular formula C19H30N2O4S and a molecular weight of 382.53 g/mol. Its IUPAC name is N-benzyl-1-(2-methoxyethylsulfonyl)-N-propan-2-ylpiperidine-3-carboxamide.
| Compound Name | N-benzyl-1-(2-methoxyethylsulfonyl)-N-propan-2-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 110335879 |
| Molecular Formula | C19H30N2O4S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | N-benzyl-1-(2-methoxyethylsulfonyl)-N-propan-2-ylpiperidine-3-carboxamide |
| SMILES | COCCS(=O)(=O)N1CCCC(C(=O)N(Cc2ccccc2)C(C)C)C1 |
| InChI | InChI=1S/C19H30N2O4S/c1-16(2)21(14-17-8-5-4-6-9-17)19(22)18-10-7-11-20(15-18)26(23,24)13-12-25-3/h4-6,8-9,16,18H,7,10-15H2,1-3H3 |
| InChIKey | UOSNNTUNGVAJTJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |