C19H26N4O — CID 110336479
(4-methylpiperazin-1-yl)-[1-methyl-5-(4-propan-2-ylphenyl)pyrazol-3-yl]methanone (PubChem CID 110336479) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is (4-methylpiperazin-1-yl)-[1-methyl-5-(4-propan-2-ylphenyl)pyrazol-3-yl]methanone.
| Compound Name | (4-methylpiperazin-1-yl)-[1-methyl-5-(4-propan-2-ylphenyl)pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 110336479 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | (4-methylpiperazin-1-yl)-[1-methyl-5-(4-propan-2-ylphenyl)pyrazol-3-yl]methanone |
| SMILES | CC(C)c1ccc(-c2cc(C(=O)N3CCN(C)CC3)nn2C)cc1 |
| InChI | InChI=1S/C19H26N4O/c1-14(2)15-5-7-16(8-6-15)18-13-17(20-22(18)4)19(24)23-11-9-21(3)10-12-23/h5-8,13-14H,9-12H2,1-4H3 |
| InChIKey | LJVQQXWDUKDILQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |