C20H24N4O2 — CID 110336572
4-[1-methyl-5-(5,6,7,8-tetrahydronaphthalen-2-yl)pyrazole-3-carbonyl]piperazine-1-carbaldehyde (PubChem CID 110336572) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 4-[1-methyl-5-(5,6,7,8-tetrahydronaphthalen-2-yl)pyrazole-3-carbonyl]piperazine-1-carbaldehyde.
| Compound Name | 4-[1-methyl-5-(5,6,7,8-tetrahydronaphthalen-2-yl)pyrazole-3-carbonyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 110336572 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 4-[1-methyl-5-(5,6,7,8-tetrahydronaphthalen-2-yl)pyrazole-3-carbonyl]piperazine-1-carbaldehyde |
| SMILES | Cn1nc(C(=O)N2CCN(C=O)CC2)cc1-c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C20H24N4O2/c1-22-19(17-7-6-15-4-2-3-5-16(15)12-17)13-18(21-22)20(26)24-10-8-23(14-25)9-11-24/h6-7,12-14H,2-5,8-11H2,1H3 |
| InChIKey | PDUWEUWSDGUPEI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|