C17H13ClFN5O2 — CID 110338572
5-[(2E)-2-[[2-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2H-1,2,4-triazin-3-one (PubChem CID 110338572) has the molecular formula C17H13ClFN5O2 and a molecular weight of 373.78 g/mol. Its IUPAC name is 5-[(2E)-2-[[2-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2H-1,2,4-triazin-3-one.
| Compound Name | 5-[(2E)-2-[[2-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2H-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 110338572 |
| Molecular Formula | C17H13ClFN5O2 |
| Molecular Weight | 373.78 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 5-[(2E)-2-[[2-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2H-1,2,4-triazin-3-one |
| SMILES | O=c1nc(N/N=C/c2ccccc2OCc2c(F)cccc2Cl)cn[nH]1 |
| InChI | InChI=1S/C17H13ClFN5O2/c18-13-5-3-6-14(19)12(13)10-26-15-7-2-1-4-11(15)8-20-23-16-9-21-24-17(25)22-16/h1-9H,10H2,(H2,22,23,24,25)/b20-8+ |
| InChIKey | DBFHFVBSWLTJIP-DNTJNYDQSA-N |
| XLogP | 2.98 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.78 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|