C16H32ClN3 — CID 11033974
[amino-(heptan-2-ylamino)methylidene]-[2-(cyclohexen-1-yl)ethyl]azanium chloride (PubChem CID 11033974) has the molecular formula C16H32ClN3 and a molecular weight of 301.91 g/mol. Its IUPAC name is [amino-(heptan-2-ylamino)methylidene]-[2-(cyclohexen-1-yl)ethyl]azanium chloride.
| Compound Name | [amino-(heptan-2-ylamino)methylidene]-[2-(cyclohexen-1-yl)ethyl]azanium chloride |
|---|---|
| PubChem CID | 11033974 |
| Molecular Formula | C16H32ClN3 |
| Molecular Weight | 301.91 g/mol |
| Exact Mass | 301.23 |
| IUPAC Name | [amino-(heptan-2-ylamino)methylidene]-[2-(cyclohexen-1-yl)ethyl]azanium chloride |
| SMILES | CCCCCC(C)N/C(N)=[NH+]/CCC1=CCCCC1.[Cl-] |
| InChI | InChI=1S/C16H31N3.ClH/c1-3-4-6-9-14(2)19-16(17)18-13-12-15-10-7-5-8-11-15;/h10,14H,3-9,11-13H2,1-2H3,(H3,17,18,19);1H |
| InChIKey | RXAJURKQXIIPKE-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.91 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|