C16H21N3O4S2 — CID 110345197
2,5-dimethyl-N-[2-(pyridin-3-ylmethylsulfamoyl)ethyl]benzenesulfonamide (PubChem CID 110345197) has the molecular formula C16H21N3O4S2 and a molecular weight of 383.50 g/mol. Its IUPAC name is 2,5-dimethyl-N-[2-(pyridin-3-ylmethylsulfamoyl)ethyl]benzenesulfonamide.
| Compound Name | 2,5-dimethyl-N-[2-(pyridin-3-ylmethylsulfamoyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110345197 |
| Molecular Formula | C16H21N3O4S2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 2,5-dimethyl-N-[2-(pyridin-3-ylmethylsulfamoyl)ethyl]benzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCCS(=O)(=O)NCc2cccnc2)c1 |
| InChI | InChI=1S/C16H21N3O4S2/c1-13-5-6-14(2)16(10-13)25(22,23)18-8-9-24(20,21)19-12-15-4-3-7-17-11-15/h3-7,10-11,18-19H,8-9,12H2,1-2H3 |
| InChIKey | GSWFMKWVLIEWMA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |