C22H24F2N2O2 — CID 110346847
1-[4-(3,4-difluorobenzoyl)piperazin-1-yl]-3-methyl-3-phenylbutan-1-one (PubChem CID 110346847) has the molecular formula C22H24F2N2O2 and a molecular weight of 386.44 g/mol. Its IUPAC name is 1-[4-(3,4-difluorobenzoyl)piperazin-1-yl]-3-methyl-3-phenylbutan-1-one.
| Compound Name | 1-[4-(3,4-difluorobenzoyl)piperazin-1-yl]-3-methyl-3-phenylbutan-1-one |
|---|---|
| PubChem CID | 110346847 |
| Molecular Formula | C22H24F2N2O2 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 1-[4-(3,4-difluorobenzoyl)piperazin-1-yl]-3-methyl-3-phenylbutan-1-one |
| SMILES | CC(C)(CC(=O)N1CCN(C(=O)c2ccc(F)c(F)c2)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H24F2N2O2/c1-22(2,17-6-4-3-5-7-17)15-20(27)25-10-12-26(13-11-25)21(28)16-8-9-18(23)19(24)14-16/h3-9,14H,10-13,15H2,1-2H3 |
| InChIKey | VNTASNGOBDOFPN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |