C20H21NO4 — CID 11035177
(3S,3aR,6aR)-2-benzyl-3-(phenylmethoxymethyl)-3,3a,6,6a-tetrahydrofuro[2,3-d][1,2]oxazol-5-one (PubChem CID 11035177) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is (3S,3aR,6aR)-2-benzyl-3-(phenylmethoxymethyl)-3,3a,6,6a-tetrahydrofuro[2,3-d][1,2]oxazol-5-one.
| Compound Name | (3S,3aR,6aR)-2-benzyl-3-(phenylmethoxymethyl)-3,3a,6,6a-tetrahydrofuro[2,3-d][1,2]oxazol-5-one |
|---|---|
| PubChem CID | 11035177 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | (3S,3aR,6aR)-2-benzyl-3-(phenylmethoxymethyl)-3,3a,6,6a-tetrahydrofuro[2,3-d][1,2]oxazol-5-one |
| SMILES | O=C1C[C@H]2ON(Cc3ccccc3)[C@@H](COCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C20H21NO4/c22-19-11-18-20(24-19)17(14-23-13-16-9-5-2-6-10-16)21(25-18)12-15-7-3-1-4-8-15/h1-10,17-18,20H,11-14H2/t17-,18+,20+/m0/s1 |
| InChIKey | HOOWUSIKCVGFHC-NLWGTHIKSA-N |
| XLogP | 2.70 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |