C24H27NO5 — CID 101221979
(1S,2S,6R,9S)-9-[(1S)-1,2-bis(phenylmethoxy)ethyl]-4,7-dioxa-8-azatricyclo[6.3.0.02,6]undecan-3-one (PubChem CID 101221979) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is (1S,2S,6R,9S)-9-[(1S)-1,2-bis(phenylmethoxy)ethyl]-4,7-dioxa-8-azatricyclo[6.3.0.02,6]undecan-3-one.
| Compound Name | (1S,2S,6R,9S)-9-[(1S)-1,2-bis(phenylmethoxy)ethyl]-4,7-dioxa-8-azatricyclo[6.3.0.02,6]undecan-3-one |
|---|---|
| PubChem CID | 101221979 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | (1S,2S,6R,9S)-9-[(1S)-1,2-bis(phenylmethoxy)ethyl]-4,7-dioxa-8-azatricyclo[6.3.0.02,6]undecan-3-one |
| SMILES | O=C1OC[C@@H]2ON3[C@@H](CC[C@H]3[C@@H](COCc3ccccc3)OCc3ccccc3)[C@H]12 |
| InChI | InChI=1S/C24H27NO5/c26-24-23-20-12-11-19(25(20)30-22(23)16-29-24)21(28-14-18-9-5-2-6-10-18)15-27-13-17-7-3-1-4-8-17/h1-10,19-23H,11-16H2/t19-,20-,21+,22-,23-/m0/s1 |
| InChIKey | FUMGFQVFCQZEMP-HPAIXVDQSA-N |
| XLogP | 3.11 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |