C30H31NO6 — CID 11081635
(1S,2R,6S,9R,10R,11S)-10,11-bis(phenylmethoxy)-9-(phenylmethoxymethyl)-4,7-dioxa-8-azatricyclo[6.3.0.02,6]undecan-3-one (PubChem CID 11081635) has the molecular formula C30H31NO6 and a molecular weight of 501.58 g/mol. Its IUPAC name is (1S,2R,6S,9R,10R,11S)-10,11-bis(phenylmethoxy)-9-(phenylmethoxymethyl)-4,7-dioxa-8-azatricyclo[6.3.0.02,6]undecan-3-one.
| Compound Name | (1S,2R,6S,9R,10R,11S)-10,11-bis(phenylmethoxy)-9-(phenylmethoxymethyl)-4,7-dioxa-8-azatricyclo[6.3.0.02,6]undecan-3-one |
|---|---|
| PubChem CID | 11081635 |
| Molecular Formula | C30H31NO6 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | (1S,2R,6S,9R,10R,11S)-10,11-bis(phenylmethoxy)-9-(phenylmethoxymethyl)-4,7-dioxa-8-azatricyclo[6.3.0.02,6]undecan-3-one |
| SMILES | O=C1OC[C@H]2ON3[C@H]([C@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@H]3COCc3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C30H31NO6/c32-30-26-25(20-36-30)37-31-24(19-33-16-21-10-4-1-5-11-21)28(34-17-22-12-6-2-7-13-22)29(27(26)31)35-18-23-14-8-3-9-15-23/h1-15,24-29H,16-20H2/t24-,25-,26+,27+,28-,29+/m1/s1 |
| InChIKey | GGMULYOLBVHTDN-LQZPZKLRSA-N |
| XLogP | 3.91 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |