C17H21NO5 — CID 53342018
methyl (1S,2R,3S,5S,7S,10R)-9-methyl-2-phenylmethoxy-4,8-dioxa-9-azatricyclo[5.2.1.03,5]decane-10-carboxylate (PubChem CID 53342018) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is methyl (1S,2R,3S,5S,7S,10R)-9-methyl-2-phenylmethoxy-4,8-dioxa-9-azatricyclo[5.2.1.03,5]decane-10-carboxylate.
| Compound Name | methyl (1S,2R,3S,5S,7S,10R)-9-methyl-2-phenylmethoxy-4,8-dioxa-9-azatricyclo[5.2.1.03,5]decane-10-carboxylate |
|---|---|
| PubChem CID | 53342018 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | methyl (1S,2R,3S,5S,7S,10R)-9-methyl-2-phenylmethoxy-4,8-dioxa-9-azatricyclo[5.2.1.03,5]decane-10-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2[C@@H](OCc3ccccc3)[C@H]3O[C@H]3C[C@@H]1ON2C |
| InChI | InChI=1S/C17H21NO5/c1-18-14-13(17(19)20-2)11(23-18)8-12-15(22-12)16(14)21-9-10-6-4-3-5-7-10/h3-7,11-16H,8-9H2,1-2H3/t11-,12-,13-,14-,15-,16+/m0/s1 |
| InChIKey | FMJWIGDPBKOFGL-OJFNHCPVSA-N |
| XLogP | 1.15 |
| TPSA | 60.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|