C28H35NO7 — CID 101221980
methyl (2S,3R,3aS,6S)-6-[(1S)-1,2-bis(phenylmethoxy)ethyl]-2-(3-methoxy-3-oxopropyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-3-carboxylate (PubChem CID 101221980) has the molecular formula C28H35NO7 and a molecular weight of 497.59 g/mol. Its IUPAC name is methyl (2S,3R,3aS,6S)-6-[(1S)-1,2-bis(phenylmethoxy)ethyl]-2-(3-methoxy-3-oxopropyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-3-carboxylate.
| Compound Name | methyl (2S,3R,3aS,6S)-6-[(1S)-1,2-bis(phenylmethoxy)ethyl]-2-(3-methoxy-3-oxopropyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-3-carboxylate |
|---|---|
| PubChem CID | 101221980 |
| Molecular Formula | C28H35NO7 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | methyl (2S,3R,3aS,6S)-6-[(1S)-1,2-bis(phenylmethoxy)ethyl]-2-(3-methoxy-3-oxopropyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-3-carboxylate |
| SMILES | COC(=O)CC[C@@H]1ON2[C@@H](CC[C@H]2[C@@H](COCc2ccccc2)OCc2ccccc2)[C@H]1C(=O)OC |
| InChI | InChI=1S/C28H35NO7/c1-32-26(30)16-15-24-27(28(31)33-2)23-14-13-22(29(23)36-24)25(35-18-21-11-7-4-8-12-21)19-34-17-20-9-5-3-6-10-20/h3-12,22-25,27H,13-19H2,1-2H3/t22-,23-,24-,25+,27+/m0/s1 |
| InChIKey | FHRKCLLNVSTILI-HDHXAKMKSA-N |
| XLogP | 3.68 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |