C17H23NO6 — CID 53342017
methyl (1S,2R,3S,4R,6S,9R)-3,4-dihydroxy-8-methyl-2-phenylmethoxy-7-oxa-8-azabicyclo[4.2.1]nonane-9-carboxylate (PubChem CID 53342017) has the molecular formula C17H23NO6 and a molecular weight of 337.37 g/mol. Its IUPAC name is methyl (1S,2R,3S,4R,6S,9R)-3,4-dihydroxy-8-methyl-2-phenylmethoxy-7-oxa-8-azabicyclo[4.2.1]nonane-9-carboxylate.
| Compound Name | methyl (1S,2R,3S,4R,6S,9R)-3,4-dihydroxy-8-methyl-2-phenylmethoxy-7-oxa-8-azabicyclo[4.2.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 53342017 |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | methyl (1S,2R,3S,4R,6S,9R)-3,4-dihydroxy-8-methyl-2-phenylmethoxy-7-oxa-8-azabicyclo[4.2.1]nonane-9-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2[C@@H](OCc3ccccc3)[C@@H](O)[C@H](O)C[C@@H]1ON2C |
| InChI | InChI=1S/C17H23NO6/c1-18-14-13(17(21)22-2)12(24-18)8-11(19)15(20)16(14)23-9-10-6-4-3-5-7-10/h3-7,11-16,19-20H,8-9H2,1-2H3/t11-,12+,13+,14+,15+,16-/m1/s1 |
| InChIKey | FRCWSTASGCBOIM-QOTRURMSSA-N |
| XLogP | 0.10 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |