C20H27NO6 — CID 53342016
methyl (1S,2R,3S,7R,9S,12R)-5,5,11-trimethyl-2-phenylmethoxy-4,6,10-trioxa-11-azatricyclo[7.2.1.03,7]dodecane-12-carboxylate (PubChem CID 53342016) has the molecular formula C20H27NO6 and a molecular weight of 377.44 g/mol. Its IUPAC name is methyl (1S,2R,3S,7R,9S,12R)-5,5,11-trimethyl-2-phenylmethoxy-4,6,10-trioxa-11-azatricyclo[7.2.1.03,7]dodecane-12-carboxylate.
| Compound Name | methyl (1S,2R,3S,7R,9S,12R)-5,5,11-trimethyl-2-phenylmethoxy-4,6,10-trioxa-11-azatricyclo[7.2.1.03,7]dodecane-12-carboxylate |
|---|---|
| PubChem CID | 53342016 |
| Molecular Formula | C20H27NO6 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | methyl (1S,2R,3S,7R,9S,12R)-5,5,11-trimethyl-2-phenylmethoxy-4,6,10-trioxa-11-azatricyclo[7.2.1.03,7]dodecane-12-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2[C@@H](OCc3ccccc3)[C@H]3OC(C)(C)O[C@@H]3C[C@@H]1ON2C |
| InChI | InChI=1S/C20H27NO6/c1-20(2)25-14-10-13-15(19(22)23-4)16(21(3)27-13)18(17(14)26-20)24-11-12-8-6-5-7-9-12/h5-9,13-18H,10-11H2,1-4H3/t13-,14+,15-,16-,17-,18+/m0/s1 |
| InChIKey | XHVQLVHOXPSOML-ONTMVUMWSA-N |
| XLogP | 1.90 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |