C34H46N2O12 — CID 139037289
methyl (1S,2R,3S,4R,6S,9R)-3,4-dihydroxy-8-methyl-2-phenylmethoxy-7-oxa-8-azabicyclo[4.2.1]nonane-9-carboxylate (PubChem CID 139037289) has the molecular formula C34H46N2O12 and a molecular weight of 674.74 g/mol. Its IUPAC name is methyl (1S,2R,3S,4R,6S,9R)-3,4-dihydroxy-8-methyl-2-phenylmethoxy-7-oxa-8-azabicyclo[4.2.1]nonane-9-carboxylate.
| Compound Name | methyl (1S,2R,3S,4R,6S,9R)-3,4-dihydroxy-8-methyl-2-phenylmethoxy-7-oxa-8-azabicyclo[4.2.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 139037289 |
| Molecular Formula | C34H46N2O12 |
| Molecular Weight | 674.74 g/mol |
| Exact Mass | 674.31 |
| IUPAC Name | methyl (1S,2R,3S,4R,6S,9R)-3,4-dihydroxy-8-methyl-2-phenylmethoxy-7-oxa-8-azabicyclo[4.2.1]nonane-9-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2[C@@H](OCc3ccccc3)[C@@H](O)[C@H](O)C[C@@H]1ON2C.COC(=O)[C@@H]1[C@H]2[C@@H](OCc3ccccc3)[C@@H](O)[C@H](O)C[C@@H]1ON2C |
| InChI | InChI=1S/2C17H23NO6/c2*1-18-14-13(17(21)22-2)12(24-18)8-11(19)15(20)16(14)23-9-10-6-4-3-5-7-10/h2*3-7,11-16,19-20H,8-9H2,1-2H3/t2*11-,12+,13+,14+,15+,16-/m11/s1 |
| InChIKey | BBMUAWPXBIMWSH-HNPXLQAGSA-N |
| XLogP | 0.20 |
| TPSA | 176.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.74 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |