C37H51NO18 — CID 102222449
ethyl (4R)-3-(1,2-diacetyloxy-3-phenylmethoxypropyl)-2-methyl-5-(1,2,3,4,5-pentaacetyloxyhexyl)-1,2-oxazolidine-4-carboxylate (PubChem CID 102222449) has the molecular formula C37H51NO18 and a molecular weight of 797.80 g/mol. Its IUPAC name is ethyl (4R)-3-(1,2-diacetyloxy-3-phenylmethoxypropyl)-2-methyl-5-(1,2,3,4,5-pentaacetyloxyhexyl)-1,2-oxazolidine-4-carboxylate.
| Compound Name | ethyl (4R)-3-(1,2-diacetyloxy-3-phenylmethoxypropyl)-2-methyl-5-(1,2,3,4,5-pentaacetyloxyhexyl)-1,2-oxazolidine-4-carboxylate |
|---|---|
| PubChem CID | 102222449 |
| Molecular Formula | C37H51NO18 |
| Molecular Weight | 797.80 g/mol |
| Exact Mass | 797.31 |
| IUPAC Name | ethyl (4R)-3-(1,2-diacetyloxy-3-phenylmethoxypropyl)-2-methyl-5-(1,2,3,4,5-pentaacetyloxyhexyl)-1,2-oxazolidine-4-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(C)OC(C)=O)ON(C)C1C(OC(C)=O)C(COCc1ccccc1)OC(C)=O |
| InChI | InChI=1S/C37H51NO18/c1-11-48-37(46)29-30(32(52-23(6)42)28(50-21(4)40)18-47-17-27-15-13-12-14-16-27)38(10)56-33(29)35(54-25(8)44)36(55-26(9)45)34(53-24(7)43)31(51-22(5)41)19(2)49-20(3)39/h12-16,19,28-36H,11,17-18H2,1-10H3/t19?,28?,29-,30?,31?,32?,33?,34?,35?,36?/m1/s1 |
| InChIKey | ATBAYUDQKIXVMM-LKCVENAZSA-N |
| XLogP | 1.54 |
| TPSA | 232.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.80 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|