C40H45NO8 — CID 11181424
ethyl (3R,5R,6R,7S,8R,9R)-2-methyl-6,7,8-tris(phenylmethoxy)-9-(phenylmethoxymethyl)-1,10-dioxa-2-azaspiro[4.5]decane-3-carboxylate (PubChem CID 11181424) has the molecular formula C40H45NO8 and a molecular weight of 667.80 g/mol. Its IUPAC name is ethyl (3R,5R,6R,7S,8R,9R)-2-methyl-6,7,8-tris(phenylmethoxy)-9-(phenylmethoxymethyl)-1,10-dioxa-2-azaspiro[4.5]decane-3-carboxylate.
| Compound Name | ethyl (3R,5R,6R,7S,8R,9R)-2-methyl-6,7,8-tris(phenylmethoxy)-9-(phenylmethoxymethyl)-1,10-dioxa-2-azaspiro[4.5]decane-3-carboxylate |
|---|---|
| PubChem CID | 11181424 |
| Molecular Formula | C40H45NO8 |
| Molecular Weight | 667.80 g/mol |
| Exact Mass | 667.31 |
| IUPAC Name | ethyl (3R,5R,6R,7S,8R,9R)-2-methyl-6,7,8-tris(phenylmethoxy)-9-(phenylmethoxymethyl)-1,10-dioxa-2-azaspiro[4.5]decane-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@@]2(O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)ON1C |
| InChI | InChI=1S/C40H45NO8/c1-3-44-39(42)34-24-40(49-41(34)2)38(47-28-33-22-14-7-15-23-33)37(46-27-32-20-12-6-13-21-32)36(45-26-31-18-10-5-11-19-31)35(48-40)29-43-25-30-16-8-4-9-17-30/h4-23,34-38H,3,24-29H2,1-2H3/t34-,35-,36-,37+,38-,40-/m1/s1 |
| InChIKey | APPYWJPNEZBRLB-XXJWWHBASA-N |
| XLogP | 6.25 |
| TPSA | 84.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.80 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |