C41H47NO8 — CID 135018016
ethyl 2-[3-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanoylamino]acetate (PubChem CID 135018016) has the molecular formula C41H47NO8 and a molecular weight of 681.83 g/mol. Its IUPAC name is ethyl 2-[3-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanoylamino]acetate.
| Compound Name | ethyl 2-[3-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanoylamino]acetate |
|---|---|
| PubChem CID | 135018016 |
| Molecular Formula | C41H47NO8 |
| Molecular Weight | 681.83 g/mol |
| Exact Mass | 681.33 |
| IUPAC Name | ethyl 2-[3-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)CC[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C41H47NO8/c1-2-46-38(44)25-42-37(43)24-23-35-39(47-27-32-17-9-4-10-18-32)41(49-29-34-21-13-6-14-22-34)40(48-28-33-19-11-5-12-20-33)36(50-35)30-45-26-31-15-7-3-8-16-31/h3-22,35-36,39-41H,2,23-30H2,1H3,(H,42,43)/t35-,36-,39+,40-,41-/m1/s1 |
| InChIKey | DHLBBNDHFOYKCK-RYPNICBYSA-N |
| XLogP | 6.19 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.83 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |