C35H42F2N2O7 — CID 57411082
ethyl 4-[(2S,3R,4R,5R,6R)-3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-2-amino-4,4-difluorobutanoate (PubChem CID 57411082) has the molecular formula C35H42F2N2O7 and a molecular weight of 640.72 g/mol. Its IUPAC name is ethyl 4-[(2S,3R,4R,5R,6R)-3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-2-amino-4,4-difluorobutanoate.
| Compound Name | ethyl 4-[(2S,3R,4R,5R,6R)-3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-2-amino-4,4-difluorobutanoate |
|---|---|
| PubChem CID | 57411082 |
| Molecular Formula | C35H42F2N2O7 |
| Molecular Weight | 640.72 g/mol |
| Exact Mass | 640.30 |
| IUPAC Name | ethyl 4-[(2S,3R,4R,5R,6R)-3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-2-amino-4,4-difluorobutanoate |
| SMILES | CCOC(=O)C(N)CC(F)(F)[C@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1NC(C)=O |
| InChI | InChI=1S/C35H42F2N2O7/c1-3-43-34(41)28(38)19-35(36,37)33-30(39-24(2)40)32(45-22-27-17-11-6-12-18-27)31(44-21-26-15-9-5-10-16-26)29(46-33)23-42-20-25-13-7-4-8-14-25/h4-18,28-33H,3,19-23,38H2,1-2H3,(H,39,40)/t28?,29-,30-,31+,32-,33+/m1/s1 |
| InChIKey | GWNBEWLAUDGJPQ-SWNJJKEISA-N |
| XLogP | 4.56 |
| TPSA | 118.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.72 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |