C17H21NO5 — CID 101488737
(1S,2R,5R,6S,12S)-5-(hydroxymethyl)-12-phenylmethoxy-4,7-dioxa-8-azatricyclo[6.4.0.02,6]dodecan-3-one (PubChem CID 101488737) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is (1S,2R,5R,6S,12S)-5-(hydroxymethyl)-12-phenylmethoxy-4,7-dioxa-8-azatricyclo[6.4.0.02,6]dodecan-3-one.
| Compound Name | (1S,2R,5R,6S,12S)-5-(hydroxymethyl)-12-phenylmethoxy-4,7-dioxa-8-azatricyclo[6.4.0.02,6]dodecan-3-one |
|---|---|
| PubChem CID | 101488737 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | (1S,2R,5R,6S,12S)-5-(hydroxymethyl)-12-phenylmethoxy-4,7-dioxa-8-azatricyclo[6.4.0.02,6]dodecan-3-one |
| SMILES | O=C1O[C@H](CO)[C@H]2ON3CCC[C@H](OCc4ccccc4)[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C17H21NO5/c19-9-13-16-14(17(20)22-13)15-12(7-4-8-18(15)23-16)21-10-11-5-2-1-3-6-11/h1-3,5-6,12-16,19H,4,7-10H2/t12-,13+,14+,15+,16+/m0/s1 |
| InChIKey | VMCIYDQPMYJIOQ-UYJHQMFVSA-N |
| XLogP | 0.88 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |