C21H29NO6 — CID 10524495
ethyl (2R)-2-[(3aR,6S,6aS)-1-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]-3a,4,6,6a-tetrahydro-3H-furo[3,4-c][1,2]oxazol-6-yl]-2-prop-2-enoxyacetate (PubChem CID 10524495) has the molecular formula C21H29NO6 and a molecular weight of 391.46 g/mol. Its IUPAC name is ethyl (2R)-2-[(3aR,6S,6aS)-1-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]-3a,4,6,6a-tetrahydro-3H-furo[3,4-c][1,2]oxazol-6-yl]-2-prop-2-enoxyacetate.
| Compound Name | ethyl (2R)-2-[(3aR,6S,6aS)-1-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]-3a,4,6,6a-tetrahydro-3H-furo[3,4-c][1,2]oxazol-6-yl]-2-prop-2-enoxyacetate |
|---|---|
| PubChem CID | 10524495 |
| Molecular Formula | C21H29NO6 |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | ethyl (2R)-2-[(3aR,6S,6aS)-1-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]-3a,4,6,6a-tetrahydro-3H-furo[3,4-c][1,2]oxazol-6-yl]-2-prop-2-enoxyacetate |
| SMILES | C=CCO[C@@H](C(=O)OCC)[C@H]1OC[C@@H]2CON([C@H](C)[C@H](O)c3ccccc3)[C@@H]21 |
| InChI | InChI=1S/C21H29NO6/c1-4-11-26-20(21(24)25-5-2)19-17-16(12-27-19)13-28-22(17)14(3)18(23)15-9-7-6-8-10-15/h4,6-10,14,16-20,23H,1,5,11-13H2,2-3H3/t14-,16-,17+,18+,19+,20-/m1/s1 |
| InChIKey | ZHIWTCRTPXBAPX-SZGLYPCISA-N |
| XLogP | 1.87 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|