C21H23NO4 — CID 14660704
(3R,3aR,6aR)-1-benzyl-3-[(1S)-1-phenylmethoxyethyl]-3,3a,6,6a-tetrahydrofuro[3,4-c][1,2]oxazol-4-one (PubChem CID 14660704) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is (3R,3aR,6aR)-1-benzyl-3-[(1S)-1-phenylmethoxyethyl]-3,3a,6,6a-tetrahydrofuro[3,4-c][1,2]oxazol-4-one.
| Compound Name | (3R,3aR,6aR)-1-benzyl-3-[(1S)-1-phenylmethoxyethyl]-3,3a,6,6a-tetrahydrofuro[3,4-c][1,2]oxazol-4-one |
|---|---|
| PubChem CID | 14660704 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | (3R,3aR,6aR)-1-benzyl-3-[(1S)-1-phenylmethoxyethyl]-3,3a,6,6a-tetrahydrofuro[3,4-c][1,2]oxazol-4-one |
| SMILES | C[C@H](OCc1ccccc1)[C@@H]1ON(Cc2ccccc2)[C@H]2COC(=O)[C@@H]12 |
| InChI | InChI=1S/C21H23NO4/c1-15(24-13-17-10-6-3-7-11-17)20-19-18(14-25-21(19)23)22(26-20)12-16-8-4-2-5-9-16/h2-11,15,18-20H,12-14H2,1H3/t15-,18-,19+,20-/m0/s1 |
| InChIKey | PQVVHZOAAZVJMP-QLIIJSOBSA-N |
| XLogP | 2.95 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |