C27H33NO6 — CID 10719064
ethyl (2R)-2-[(3aR,6S,6aS)-1-[(2S)-1-hydroxy-1,1-diphenylpropan-2-yl]-3a,4,6,6a-tetrahydro-3H-furo[3,4-c][1,2]oxazol-6-yl]-2-prop-2-enoxyacetate (PubChem CID 10719064) has the molecular formula C27H33NO6 and a molecular weight of 467.56 g/mol. Its IUPAC name is ethyl (2R)-2-[(3aR,6S,6aS)-1-[(2S)-1-hydroxy-1,1-diphenylpropan-2-yl]-3a,4,6,6a-tetrahydro-3H-furo[3,4-c][1,2]oxazol-6-yl]-2-prop-2-enoxyacetate.
| Compound Name | ethyl (2R)-2-[(3aR,6S,6aS)-1-[(2S)-1-hydroxy-1,1-diphenylpropan-2-yl]-3a,4,6,6a-tetrahydro-3H-furo[3,4-c][1,2]oxazol-6-yl]-2-prop-2-enoxyacetate |
|---|---|
| PubChem CID | 10719064 |
| Molecular Formula | C27H33NO6 |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | ethyl (2R)-2-[(3aR,6S,6aS)-1-[(2S)-1-hydroxy-1,1-diphenylpropan-2-yl]-3a,4,6,6a-tetrahydro-3H-furo[3,4-c][1,2]oxazol-6-yl]-2-prop-2-enoxyacetate |
| SMILES | C=CCO[C@@H](C(=O)OCC)[C@H]1OC[C@@H]2CON([C@@H](C)C(O)(c3ccccc3)c3ccccc3)[C@@H]21 |
| InChI | InChI=1S/C27H33NO6/c1-4-16-32-25(26(29)31-5-2)24-23-20(17-33-24)18-34-28(23)19(3)27(30,21-12-8-6-9-13-21)22-14-10-7-11-15-22/h4,6-15,19-20,23-25,30H,1,5,16-18H2,2-3H3/t19-,20+,23-,24-,25+/m0/s1 |
| InChIKey | VRWBGZSNSOQWJV-VLNNBNGDSA-N |
| XLogP | 3.08 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|