C25H35NO6 — CID 10950353
benzyl (2R,3R,5S)-5-[2-[[(1S,7R,8R)-7-hydroxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methoxy]-2-oxoethyl]-2,3,5-trimethyloxolane-2-carboxylate (PubChem CID 10950353) has the molecular formula C25H35NO6 and a molecular weight of 445.56 g/mol. Its IUPAC name is benzyl (2R,3R,5S)-5-[2-[[(1S,7R,8R)-7-hydroxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methoxy]-2-oxoethyl]-2,3,5-trimethyloxolane-2-carboxylate.
| Compound Name | benzyl (2R,3R,5S)-5-[2-[[(1S,7R,8R)-7-hydroxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methoxy]-2-oxoethyl]-2,3,5-trimethyloxolane-2-carboxylate |
|---|---|
| PubChem CID | 10950353 |
| Molecular Formula | C25H35NO6 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | benzyl (2R,3R,5S)-5-[2-[[(1S,7R,8R)-7-hydroxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methoxy]-2-oxoethyl]-2,3,5-trimethyloxolane-2-carboxylate |
| SMILES | C[C@@H]1C[C@@](C)(CC(=O)OC[C@H]2CCN3CC[C@@H](O)[C@@H]23)O[C@@]1(C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H35NO6/c1-17-13-24(2,32-25(17,3)23(29)31-15-18-7-5-4-6-8-18)14-21(28)30-16-19-9-11-26-12-10-20(27)22(19)26/h4-8,17,19-20,22,27H,9-16H2,1-3H3/t17-,19-,20-,22-,24+,25-/m1/s1 |
| InChIKey | JKKPZYQNMBLQLY-COCBNOESSA-N |
| XLogP | 2.69 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |