C17H16FN3O3S — CID 110352078
4-fluoro-2-methyl-N-[(3-methyl-4-oxoquinazolin-2-yl)methyl]benzenesulfonamide (PubChem CID 110352078) has the molecular formula C17H16FN3O3S and a molecular weight of 361.40 g/mol. Its IUPAC name is 4-fluoro-2-methyl-N-[(3-methyl-4-oxoquinazolin-2-yl)methyl]benzenesulfonamide.
| Compound Name | 4-fluoro-2-methyl-N-[(3-methyl-4-oxoquinazolin-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110352078 |
| Molecular Formula | C17H16FN3O3S |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 4-fluoro-2-methyl-N-[(3-methyl-4-oxoquinazolin-2-yl)methyl]benzenesulfonamide |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)NCc1nc2ccccc2c(=O)n1C |
| InChI | InChI=1S/C17H16FN3O3S/c1-11-9-12(18)7-8-15(11)25(23,24)19-10-16-20-14-6-4-3-5-13(14)17(22)21(16)2/h3-9,19H,10H2,1-2H3 |
| InChIKey | IVUCOVKXKGPHBB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |