C19H18N2O3S — CID 110354990
3-(4-methyl-1,3-thiazol-2-yl)-N-(2-phenoxyethoxy)benzamide (PubChem CID 110354990) has the molecular formula C19H18N2O3S and a molecular weight of 354.43 g/mol. Its IUPAC name is 3-(4-methyl-1,3-thiazol-2-yl)-N-(2-phenoxyethoxy)benzamide.
| Compound Name | 3-(4-methyl-1,3-thiazol-2-yl)-N-(2-phenoxyethoxy)benzamide |
|---|---|
| PubChem CID | 110354990 |
| Molecular Formula | C19H18N2O3S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 3-(4-methyl-1,3-thiazol-2-yl)-N-(2-phenoxyethoxy)benzamide |
| SMILES | Cc1csc(-c2cccc(C(=O)NOCCOc3ccccc3)c2)n1 |
| InChI | InChI=1S/C19H18N2O3S/c1-14-13-25-19(20-14)16-7-5-6-15(12-16)18(22)21-24-11-10-23-17-8-3-2-4-9-17/h2-9,12-13H,10-11H2,1H3,(H,21,22) |
| InChIKey | CFVGNEOHPPHBBV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|