C16H20BrN3OS — CID 110359502
3-bromo-N-[[4-(diethylaminomethyl)-1,3-thiazol-2-yl]methyl]benzamide (PubChem CID 110359502) has the molecular formula C16H20BrN3OS and a molecular weight of 382.33 g/mol. Its IUPAC name is 3-bromo-N-[[4-(diethylaminomethyl)-1,3-thiazol-2-yl]methyl]benzamide.
| Compound Name | 3-bromo-N-[[4-(diethylaminomethyl)-1,3-thiazol-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 110359502 |
| Molecular Formula | C16H20BrN3OS |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 3-bromo-N-[[4-(diethylaminomethyl)-1,3-thiazol-2-yl]methyl]benzamide |
| SMILES | CCN(CC)Cc1csc(CNC(=O)c2cccc(Br)c2)n1 |
| InChI | InChI=1S/C16H20BrN3OS/c1-3-20(4-2)10-14-11-22-15(19-14)9-18-16(21)12-6-5-7-13(17)8-12/h5-8,11H,3-4,9-10H2,1-2H3,(H,18,21) |
| InChIKey | YQYMSYOCCURCBT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |