C18H24N2O2S — CID 110362932
N-[2-(2-methylphenyl)-2-pyridin-2-ylethyl]butane-1-sulfonamide (PubChem CID 110362932) has the molecular formula C18H24N2O2S and a molecular weight of 332.47 g/mol. Its IUPAC name is N-[2-(2-methylphenyl)-2-pyridin-2-ylethyl]butane-1-sulfonamide.
| Compound Name | N-[2-(2-methylphenyl)-2-pyridin-2-ylethyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 110362932 |
| Molecular Formula | C18H24N2O2S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | N-[2-(2-methylphenyl)-2-pyridin-2-ylethyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)NCC(c1ccccn1)c1ccccc1C |
| InChI | InChI=1S/C18H24N2O2S/c1-3-4-13-23(21,22)20-14-17(18-11-7-8-12-19-18)16-10-6-5-9-15(16)2/h5-12,17,20H,3-4,13-14H2,1-2H3 |
| InChIKey | QIRICFMMWCMYLG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |