C14H19NO4S — CID 131702580
N-[2,2-bis(furan-2-yl)ethyl]butane-1-sulfonamide (PubChem CID 131702580) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is N-[2,2-bis(furan-2-yl)ethyl]butane-1-sulfonamide.
| Compound Name | N-[2,2-bis(furan-2-yl)ethyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 131702580 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | N-[2,2-bis(furan-2-yl)ethyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)NCC(c1ccco1)c1ccco1 |
| InChI | InChI=1S/C14H19NO4S/c1-2-3-10-20(16,17)15-11-12(13-6-4-8-18-13)14-7-5-9-19-14/h4-9,12,15H,2-3,10-11H2,1H3 |
| InChIKey | UIMNXIRJNXFSMG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |