C13H15NO4S — CID 131701798
N-[2,2-bis(furan-2-yl)ethyl]cyclopropanesulfonamide (PubChem CID 131701798) has the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. Its IUPAC name is N-[2,2-bis(furan-2-yl)ethyl]cyclopropanesulfonamide.
| Compound Name | N-[2,2-bis(furan-2-yl)ethyl]cyclopropanesulfonamide |
|---|---|
| PubChem CID | 131701798 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | N-[2,2-bis(furan-2-yl)ethyl]cyclopropanesulfonamide |
| SMILES | O=S(=O)(NCC(c1ccco1)c1ccco1)C1CC1 |
| InChI | InChI=1S/C13H15NO4S/c15-19(16,10-5-6-10)14-9-11(12-3-1-7-17-12)13-4-2-8-18-13/h1-4,7-8,10-11,14H,5-6,9H2 |
| InChIKey | DEHRMPOWLAGCLB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |