C11H14BrNO3S — CID 110364445
2-(3-bromophenyl)-4-methylsulfonylmorpholine (PubChem CID 110364445) has the molecular formula C11H14BrNO3S and a molecular weight of 320.21 g/mol. Its IUPAC name is 2-(3-bromophenyl)-4-methylsulfonylmorpholine.
| Compound Name | 2-(3-bromophenyl)-4-methylsulfonylmorpholine |
|---|---|
| PubChem CID | 110364445 |
| Molecular Formula | C11H14BrNO3S |
| Molecular Weight | 320.21 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | 2-(3-bromophenyl)-4-methylsulfonylmorpholine |
| SMILES | CS(=O)(=O)N1CCOC(c2cccc(Br)c2)C1 |
| InChI | InChI=1S/C11H14BrNO3S/c1-17(14,15)13-5-6-16-11(8-13)9-3-2-4-10(12)7-9/h2-4,7,11H,5-6,8H2,1H3 |
| InChIKey | ISWGELGCHRBPTL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.21 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |