C14H20BrNO3 — CID 99640543
(2S)-2-(3-bromophenyl)-4-(2,2-dimethoxyethyl)morpholine (PubChem CID 99640543) has the molecular formula C14H20BrNO3 and a molecular weight of 330.22 g/mol. Its IUPAC name is (2S)-2-(3-bromophenyl)-4-(2,2-dimethoxyethyl)morpholine.
| Compound Name | (2S)-2-(3-bromophenyl)-4-(2,2-dimethoxyethyl)morpholine |
|---|---|
| PubChem CID | 99640543 |
| Molecular Formula | C14H20BrNO3 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | (2S)-2-(3-bromophenyl)-4-(2,2-dimethoxyethyl)morpholine |
| SMILES | COC(CN1CCO[C@@H](c2cccc(Br)c2)C1)OC |
| InChI | InChI=1S/C14H20BrNO3/c1-17-14(18-2)10-16-6-7-19-13(9-16)11-4-3-5-12(15)8-11/h3-5,8,13-14H,6-7,9-10H2,1-2H3/t13-/m1/s1 |
| InChIKey | SUUMPJASDHKLEZ-CYBMUJFWSA-N |
| XLogP | 2.44 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|