C15H20BrNO4 — CID 97317840
methyl (2S)-3-[(2R)-2-(3-bromophenyl)morpholin-4-yl]-2-hydroxy-2-methylpropanoate (PubChem CID 97317840) has the molecular formula C15H20BrNO4 and a molecular weight of 358.23 g/mol. Its IUPAC name is methyl (2S)-3-[(2R)-2-(3-bromophenyl)morpholin-4-yl]-2-hydroxy-2-methylpropanoate.
| Compound Name | methyl (2S)-3-[(2R)-2-(3-bromophenyl)morpholin-4-yl]-2-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 97317840 |
| Molecular Formula | C15H20BrNO4 |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | methyl (2S)-3-[(2R)-2-(3-bromophenyl)morpholin-4-yl]-2-hydroxy-2-methylpropanoate |
| SMILES | COC(=O)[C@@](C)(O)CN1CCO[C@H](c2cccc(Br)c2)C1 |
| InChI | InChI=1S/C15H20BrNO4/c1-15(19,14(18)20-2)10-17-6-7-21-13(9-17)11-4-3-5-12(16)8-11/h3-5,8,13,19H,6-7,9-10H2,1-2H3/t13-,15-/m0/s1 |
| InChIKey | XEYBVDKSXOUEBL-ZFWWWQNUSA-N |
| XLogP | 1.75 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |