C19H21FN2O3S — CID 110365411
[4-[(4-fluorophenyl)methylsulfonyl]piperazin-1-yl]-(2-methylphenyl)methanone (PubChem CID 110365411) has the molecular formula C19H21FN2O3S and a molecular weight of 376.45 g/mol. Its IUPAC name is [4-[(4-fluorophenyl)methylsulfonyl]piperazin-1-yl]-(2-methylphenyl)methanone.
| Compound Name | [4-[(4-fluorophenyl)methylsulfonyl]piperazin-1-yl]-(2-methylphenyl)methanone |
|---|---|
| PubChem CID | 110365411 |
| Molecular Formula | C19H21FN2O3S |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | [4-[(4-fluorophenyl)methylsulfonyl]piperazin-1-yl]-(2-methylphenyl)methanone |
| SMILES | Cc1ccccc1C(=O)N1CCN(S(=O)(=O)Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H21FN2O3S/c1-15-4-2-3-5-18(15)19(23)21-10-12-22(13-11-21)26(24,25)14-16-6-8-17(20)9-7-16/h2-9H,10-14H2,1H3 |
| InChIKey | RWXYHQADNRSOTK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |